C20H27BrClNO2 — CID 17156741
N-[(5-bromo-2-ethoxy-3-methoxyphenyl)methyl]-1-phenylbutan-1-amine;hydrochloride (PubChem CID 17156741) has the molecular formula C20H27BrClNO2 and a molecular weight of 428.80 g/mol. Its IUPAC name is N-[(5-bromo-2-ethoxy-3-methoxyphenyl)methyl]-1-phenylbutan-1-amine;hydrochloride.
| Compound Name | N-[(5-bromo-2-ethoxy-3-methoxyphenyl)methyl]-1-phenylbutan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17156741 |
| Molecular Formula | C20H27BrClNO2 |
| Molecular Weight | 428.80 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | N-[(5-bromo-2-ethoxy-3-methoxyphenyl)methyl]-1-phenylbutan-1-amine;hydrochloride |
| SMILES | CCCC(NCc1cc(Br)cc(OC)c1OCC)c1ccccc1.Cl |
| InChI | InChI=1S/C20H26BrNO2.ClH/c1-4-9-18(15-10-7-6-8-11-15)22-14-16-12-17(21)13-19(23-3)20(16)24-5-2;/h6-8,10-13,18,22H,4-5,9,14H2,1-3H3;1H |
| InChIKey | ANCBFIHUJCJVNP-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.80 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |