C21H26BrNO2 — CID 17156385
N-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methyl]-1-phenylbutan-1-amine (PubChem CID 17156385) has the molecular formula C21H26BrNO2 and a molecular weight of 404.35 g/mol. Its IUPAC name is N-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methyl]-1-phenylbutan-1-amine.
| Compound Name | N-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methyl]-1-phenylbutan-1-amine |
|---|---|
| PubChem CID | 17156385 |
| Molecular Formula | C21H26BrNO2 |
| Molecular Weight | 404.35 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | N-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methyl]-1-phenylbutan-1-amine |
| SMILES | C=CCOc1c(Br)cc(CNC(CCC)c2ccccc2)cc1OC |
| InChI | InChI=1S/C21H26BrNO2/c1-4-9-19(17-10-7-6-8-11-17)23-15-16-13-18(22)21(25-12-5-2)20(14-16)24-3/h5-8,10-11,13-14,19,23H,2,4,9,12,15H2,1,3H3 |
| InChIKey | RZRHXYAHBFTDIQ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.35 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|