C22H30ClNO2 — CID 17156010
N-[(3-ethoxy-4-prop-2-enoxyphenyl)methyl]-1-phenylbutan-1-amine;hydrochloride (PubChem CID 17156010) has the molecular formula C22H30ClNO2 and a molecular weight of 375.94 g/mol. Its IUPAC name is N-[(3-ethoxy-4-prop-2-enoxyphenyl)methyl]-1-phenylbutan-1-amine;hydrochloride.
| Compound Name | N-[(3-ethoxy-4-prop-2-enoxyphenyl)methyl]-1-phenylbutan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17156010 |
| Molecular Formula | C22H30ClNO2 |
| Molecular Weight | 375.94 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | N-[(3-ethoxy-4-prop-2-enoxyphenyl)methyl]-1-phenylbutan-1-amine;hydrochloride |
| SMILES | C=CCOc1ccc(CNC(CCC)c2ccccc2)cc1OCC.Cl |
| InChI | InChI=1S/C22H29NO2.ClH/c1-4-10-20(19-11-8-7-9-12-19)23-17-18-13-14-21(25-15-5-2)22(16-18)24-6-3;/h5,7-9,11-14,16,20,23H,2,4,6,10,15,17H2,1,3H3;1H |
| InChIKey | LDQBXPQBLGTCQX-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.94 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|