C19H22BrNO2 — CID 2217269
(1S)-N-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methyl]-1-phenylethanamine (PubChem CID 2217269) has the molecular formula C19H22BrNO2 and a molecular weight of 376.29 g/mol. Its IUPAC name is (1S)-N-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methyl]-1-phenylethanamine.
| Compound Name | (1S)-N-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methyl]-1-phenylethanamine |
|---|---|
| PubChem CID | 2217269 |
| Molecular Formula | C19H22BrNO2 |
| Molecular Weight | 376.29 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | (1S)-N-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methyl]-1-phenylethanamine |
| SMILES | C=CCOc1c(Br)cc(CN[C@@H](C)c2ccccc2)cc1OC |
| InChI | InChI=1S/C19H22BrNO2/c1-4-10-23-19-17(20)11-15(12-18(19)22-3)13-21-14(2)16-8-6-5-7-9-16/h4-9,11-12,14,21H,1,10,13H2,2-3H3/t14-/m0/s1 |
| InChIKey | UJOYCJHNNZPPHR-AWEZNQCLSA-N |
| XLogP | 4.87 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.29 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|