C21H26BrNO4S — CID 112800109
N-[(3-bromo-5-ethoxy-4-prop-2-enoxyphenyl)methyl]-1-(4-methylsulfonylphenyl)ethanamine (PubChem CID 112800109) has the molecular formula C21H26BrNO4S and a molecular weight of 468.41 g/mol. Its IUPAC name is N-[(3-bromo-5-ethoxy-4-prop-2-enoxyphenyl)methyl]-1-(4-methylsulfonylphenyl)ethanamine.
| Compound Name | N-[(3-bromo-5-ethoxy-4-prop-2-enoxyphenyl)methyl]-1-(4-methylsulfonylphenyl)ethanamine |
|---|---|
| PubChem CID | 112800109 |
| Molecular Formula | C21H26BrNO4S |
| Molecular Weight | 468.41 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | N-[(3-bromo-5-ethoxy-4-prop-2-enoxyphenyl)methyl]-1-(4-methylsulfonylphenyl)ethanamine |
| SMILES | C=CCOc1c(Br)cc(CNC(C)c2ccc(S(C)(=O)=O)cc2)cc1OCC |
| InChI | InChI=1S/C21H26BrNO4S/c1-5-11-27-21-19(22)12-16(13-20(21)26-6-2)14-23-15(3)17-7-9-18(10-8-17)28(4,24)25/h5,7-10,12-13,15,23H,1,6,11,14H2,2-4H3 |
| InChIKey | BWMPVOWLSKEUKX-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.41 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|