C25H28BrNO2 — CID 51994295
(1S)-N-[[3-bromo-5-ethoxy-4-[(2-methylphenyl)methoxy]phenyl]methyl]-1-phenylethanamine (PubChem CID 51994295) has the molecular formula C25H28BrNO2 and a molecular weight of 454.41 g/mol. Its IUPAC name is (1S)-N-[[3-bromo-5-ethoxy-4-[(2-methylphenyl)methoxy]phenyl]methyl]-1-phenylethanamine.
| Compound Name | (1S)-N-[[3-bromo-5-ethoxy-4-[(2-methylphenyl)methoxy]phenyl]methyl]-1-phenylethanamine |
|---|---|
| PubChem CID | 51994295 |
| Molecular Formula | C25H28BrNO2 |
| Molecular Weight | 454.41 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | (1S)-N-[[3-bromo-5-ethoxy-4-[(2-methylphenyl)methoxy]phenyl]methyl]-1-phenylethanamine |
| SMILES | CCOc1cc(CN[C@@H](C)c2ccccc2)cc(Br)c1OCc1ccccc1C |
| InChI | InChI=1S/C25H28BrNO2/c1-4-28-24-15-20(16-27-19(3)21-11-6-5-7-12-21)14-23(26)25(24)29-17-22-13-9-8-10-18(22)2/h5-15,19,27H,4,16-17H2,1-3H3/t19-/m0/s1 |
| InChIKey | HHPCMFGNBLFTRC-IBGZPJMESA-N |
| XLogP | 6.59 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.41 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |