C18H21Br2NO2 — CID 30620804
(1R)-N-[(3-bromo-4-ethoxy-5-methoxyphenyl)methyl]-1-(4-bromophenyl)ethanamine (PubChem CID 30620804) has the molecular formula C18H21Br2NO2 and a molecular weight of 443.18 g/mol. Its IUPAC name is (1R)-N-[(3-bromo-4-ethoxy-5-methoxyphenyl)methyl]-1-(4-bromophenyl)ethanamine.
| Compound Name | (1R)-N-[(3-bromo-4-ethoxy-5-methoxyphenyl)methyl]-1-(4-bromophenyl)ethanamine |
|---|---|
| PubChem CID | 30620804 |
| Molecular Formula | C18H21Br2NO2 |
| Molecular Weight | 443.18 g/mol |
| Exact Mass | 440.99 |
| IUPAC Name | (1R)-N-[(3-bromo-4-ethoxy-5-methoxyphenyl)methyl]-1-(4-bromophenyl)ethanamine |
| SMILES | CCOc1c(Br)cc(CN[C@H](C)c2ccc(Br)cc2)cc1OC |
| InChI | InChI=1S/C18H21Br2NO2/c1-4-23-18-16(20)9-13(10-17(18)22-3)11-21-12(2)14-5-7-15(19)8-6-14/h5-10,12,21H,4,11H2,1-3H3/t12-/m1/s1 |
| InChIKey | GUAFDRJDDKIOLT-GFCCVEGCSA-N |
| XLogP | 5.47 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.18 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |