C15H24BrNO3 — CID 111448708
3-[(3-bromo-4-ethoxy-5-methoxyphenyl)methylamino]-2-methylbutan-1-ol (PubChem CID 111448708) has the molecular formula C15H24BrNO3 and a molecular weight of 346.27 g/mol. Its IUPAC name is 3-[(3-bromo-4-ethoxy-5-methoxyphenyl)methylamino]-2-methylbutan-1-ol.
| Compound Name | 3-[(3-bromo-4-ethoxy-5-methoxyphenyl)methylamino]-2-methylbutan-1-ol |
|---|---|
| PubChem CID | 111448708 |
| Molecular Formula | C15H24BrNO3 |
| Molecular Weight | 346.27 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 3-[(3-bromo-4-ethoxy-5-methoxyphenyl)methylamino]-2-methylbutan-1-ol |
| SMILES | CCOc1c(Br)cc(CNC(C)C(C)CO)cc1OC |
| InChI | InChI=1S/C15H24BrNO3/c1-5-20-15-13(16)6-12(7-14(15)19-4)8-17-11(3)10(2)9-18/h6-7,10-11,17-18H,5,8-9H2,1-4H3 |
| InChIKey | WOTJTWSYKKACDB-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.27 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |