C20H27NO3 — CID 17156114
1-phenyl-N-[(2,4,5-trimethoxyphenyl)methyl]butan-1-amine (PubChem CID 17156114) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is 1-phenyl-N-[(2,4,5-trimethoxyphenyl)methyl]butan-1-amine.
| Compound Name | 1-phenyl-N-[(2,4,5-trimethoxyphenyl)methyl]butan-1-amine |
|---|---|
| PubChem CID | 17156114 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 1-phenyl-N-[(2,4,5-trimethoxyphenyl)methyl]butan-1-amine |
| SMILES | CCCC(NCc1cc(OC)c(OC)cc1OC)c1ccccc1 |
| InChI | InChI=1S/C20H27NO3/c1-5-9-17(15-10-7-6-8-11-15)21-14-16-12-19(23-3)20(24-4)13-18(16)22-2/h6-8,10-13,17,21H,5,9,14H2,1-4H3 |
| InChIKey | QGDYZHDBWKWUCP-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |