C18H23NO2 — CID 62050261
N-[(2,5-dimethoxyphenyl)methyl]-1-phenylpropan-1-amine (PubChem CID 62050261) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is N-[(2,5-dimethoxyphenyl)methyl]-1-phenylpropan-1-amine.
| Compound Name | N-[(2,5-dimethoxyphenyl)methyl]-1-phenylpropan-1-amine |
|---|---|
| PubChem CID | 62050261 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | N-[(2,5-dimethoxyphenyl)methyl]-1-phenylpropan-1-amine |
| SMILES | CCC(NCc1cc(OC)ccc1OC)c1ccccc1 |
| InChI | InChI=1S/C18H23NO2/c1-4-17(14-8-6-5-7-9-14)19-13-15-12-16(20-2)10-11-18(15)21-3/h5-12,17,19H,4,13H2,1-3H3 |
| InChIKey | SUFBYCXNEDBCAA-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |