C18H23NO4 — CID 3744836
2-phenyl-2-[(2,3,4-trimethoxyphenyl)methylamino]ethanol (PubChem CID 3744836) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is 2-phenyl-2-[(2,3,4-trimethoxyphenyl)methylamino]ethanol.
| Compound Name | 2-phenyl-2-[(2,3,4-trimethoxyphenyl)methylamino]ethanol |
|---|---|
| PubChem CID | 3744836 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 2-phenyl-2-[(2,3,4-trimethoxyphenyl)methylamino]ethanol |
| SMILES | COc1ccc(CNC(CO)c2ccccc2)c(OC)c1OC |
| InChI | InChI=1S/C18H23NO4/c1-21-16-10-9-14(17(22-2)18(16)23-3)11-19-15(12-20)13-7-5-4-6-8-13/h4-10,15,19-20H,11-12H2,1-3H3 |
| InChIKey | FRVAXXFBVSBURE-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |