C15H25NO4 — CID 115644564
2-methyl-3-[(2,4,5-trimethoxyphenyl)methylamino]butan-1-ol (PubChem CID 115644564) has the molecular formula C15H25NO4 and a molecular weight of 283.37 g/mol. Its IUPAC name is 2-methyl-3-[(2,4,5-trimethoxyphenyl)methylamino]butan-1-ol.
| Compound Name | 2-methyl-3-[(2,4,5-trimethoxyphenyl)methylamino]butan-1-ol |
|---|---|
| PubChem CID | 115644564 |
| Molecular Formula | C15H25NO4 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 2-methyl-3-[(2,4,5-trimethoxyphenyl)methylamino]butan-1-ol |
| SMILES | COc1cc(OC)c(OC)cc1CNC(C)C(C)CO |
| InChI | InChI=1S/C15H25NO4/c1-10(9-17)11(2)16-8-12-6-14(19-4)15(20-5)7-13(12)18-3/h6-7,10-11,16-17H,8-9H2,1-5H3 |
| InChIKey | GGTTXQJEFPRVPD-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |