C16H27NO4 — CID 103701021
4-methyl-3-[(2,4,5-trimethoxyphenyl)methylamino]pentan-1-ol (PubChem CID 103701021) has the molecular formula C16H27NO4 and a molecular weight of 297.40 g/mol. Its IUPAC name is 4-methyl-3-[(2,4,5-trimethoxyphenyl)methylamino]pentan-1-ol.
| Compound Name | 4-methyl-3-[(2,4,5-trimethoxyphenyl)methylamino]pentan-1-ol |
|---|---|
| PubChem CID | 103701021 |
| Molecular Formula | C16H27NO4 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 4-methyl-3-[(2,4,5-trimethoxyphenyl)methylamino]pentan-1-ol |
| SMILES | COc1cc(OC)c(OC)cc1CNC(CCO)C(C)C |
| InChI | InChI=1S/C16H27NO4/c1-11(2)13(6-7-18)17-10-12-8-15(20-4)16(21-5)9-14(12)19-3/h8-9,11,13,17-18H,6-7,10H2,1-5H3 |
| InChIKey | QPNBOLJCVMHCQA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |