C16H27NO3S — CID 115660533
4-ethylsulfanyl-N-[(2,4,5-trimethoxyphenyl)methyl]butan-2-amine (PubChem CID 115660533) has the molecular formula C16H27NO3S and a molecular weight of 313.46 g/mol. Its IUPAC name is 4-ethylsulfanyl-N-[(2,4,5-trimethoxyphenyl)methyl]butan-2-amine.
| Compound Name | 4-ethylsulfanyl-N-[(2,4,5-trimethoxyphenyl)methyl]butan-2-amine |
|---|---|
| PubChem CID | 115660533 |
| Molecular Formula | C16H27NO3S |
| Molecular Weight | 313.46 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 4-ethylsulfanyl-N-[(2,4,5-trimethoxyphenyl)methyl]butan-2-amine |
| SMILES | CCSCCC(C)NCc1cc(OC)c(OC)cc1OC |
| InChI | InChI=1S/C16H27NO3S/c1-6-21-8-7-12(2)17-11-13-9-15(19-4)16(20-5)10-14(13)18-3/h9-10,12,17H,6-8,11H2,1-5H3 |
| InChIKey | YIWGHIRKBKSBJE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|