C16H27NO4 — CID 103859360
2-methyl-5-[(2,4,5-trimethoxyphenyl)methylamino]pentan-1-ol (PubChem CID 103859360) has the molecular formula C16H27NO4 and a molecular weight of 297.40 g/mol. Its IUPAC name is 2-methyl-5-[(2,4,5-trimethoxyphenyl)methylamino]pentan-1-ol.
| Compound Name | 2-methyl-5-[(2,4,5-trimethoxyphenyl)methylamino]pentan-1-ol |
|---|---|
| PubChem CID | 103859360 |
| Molecular Formula | C16H27NO4 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 2-methyl-5-[(2,4,5-trimethoxyphenyl)methylamino]pentan-1-ol |
| SMILES | COc1cc(OC)c(OC)cc1CNCCCC(C)CO |
| InChI | InChI=1S/C16H27NO4/c1-12(11-18)6-5-7-17-10-13-8-15(20-3)16(21-4)9-14(13)19-2/h8-9,12,17-18H,5-7,10-11H2,1-4H3 |
| InChIKey | DFLAQNMTFAFDCB-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|