C10H14Br2ClNO2 — CID 17290053
2-[(3,5-dibromo-2-methoxyphenyl)methylamino]ethanol;hydrochloride (PubChem CID 17290053) has the molecular formula C10H14Br2ClNO2 and a molecular weight of 375.49 g/mol. Its IUPAC name is 2-[(3,5-dibromo-2-methoxyphenyl)methylamino]ethanol;hydrochloride.
| Compound Name | 2-[(3,5-dibromo-2-methoxyphenyl)methylamino]ethanol;hydrochloride |
|---|---|
| PubChem CID | 17290053 |
| Molecular Formula | C10H14Br2ClNO2 |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 372.91 |
| IUPAC Name | 2-[(3,5-dibromo-2-methoxyphenyl)methylamino]ethanol;hydrochloride |
| SMILES | COc1c(Br)cc(Br)cc1CNCCO.Cl |
| InChI | InChI=1S/C10H13Br2NO2.ClH/c1-15-10-7(6-13-2-3-14)4-8(11)5-9(10)12;/h4-5,13-14H,2-3,6H2,1H3;1H |
| InChIKey | YICADMTYUOTVKE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|