C15H24Br2N2O2 — CID 29241687
2-[3-[(3,5-dibromo-2-propoxyphenyl)methylamino]propylamino]ethanol (PubChem CID 29241687) has the molecular formula C15H24Br2N2O2 and a molecular weight of 424.18 g/mol. Its IUPAC name is 2-[3-[(3,5-dibromo-2-propoxyphenyl)methylamino]propylamino]ethanol.
| Compound Name | 2-[3-[(3,5-dibromo-2-propoxyphenyl)methylamino]propylamino]ethanol |
|---|---|
| PubChem CID | 29241687 |
| Molecular Formula | C15H24Br2N2O2 |
| Molecular Weight | 424.18 g/mol |
| Exact Mass | 422.02 |
| IUPAC Name | 2-[3-[(3,5-dibromo-2-propoxyphenyl)methylamino]propylamino]ethanol |
| SMILES | CCCOc1c(Br)cc(Br)cc1CNCCCNCCO |
| InChI | InChI=1S/C15H24Br2N2O2/c1-2-8-21-15-12(9-13(16)10-14(15)17)11-19-5-3-4-18-6-7-20/h9-10,18-20H,2-8,11H2,1H3 |
| InChIKey | HTZIQKKQSJMEDB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.18 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|