C15H24BrNO3 — CID 115961322
2-[2-[4-bromo-2-methyl-6-(propylaminomethyl)phenoxy]ethoxy]ethanol (PubChem CID 115961322) has the molecular formula C15H24BrNO3 and a molecular weight of 346.27 g/mol. Its IUPAC name is 2-[2-[4-bromo-2-methyl-6-(propylaminomethyl)phenoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[4-bromo-2-methyl-6-(propylaminomethyl)phenoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 115961322 |
| Molecular Formula | C15H24BrNO3 |
| Molecular Weight | 346.27 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 2-[2-[4-bromo-2-methyl-6-(propylaminomethyl)phenoxy]ethoxy]ethanol |
| SMILES | CCCNCc1cc(Br)cc(C)c1OCCOCCO |
| InChI | InChI=1S/C15H24BrNO3/c1-3-4-17-11-13-10-14(16)9-12(2)15(13)20-8-7-19-6-5-18/h9-10,17-18H,3-8,11H2,1-2H3 |
| InChIKey | HPEWKXMYTFQYBC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.27 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|