C18H24Br2N2O — CID 141103655
N'-cyclohexa-2,4-dien-1-yl-N-[(3,5-dibromo-2-ethoxyphenyl)methyl]propane-1,3-diamine (PubChem CID 141103655) has the molecular formula C18H24Br2N2O and a molecular weight of 444.21 g/mol. Its IUPAC name is N'-cyclohexa-2,4-dien-1-yl-N-[(3,5-dibromo-2-ethoxyphenyl)methyl]propane-1,3-diamine.
| Compound Name | N'-cyclohexa-2,4-dien-1-yl-N-[(3,5-dibromo-2-ethoxyphenyl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 141103655 |
| Molecular Formula | C18H24Br2N2O |
| Molecular Weight | 444.21 g/mol |
| Exact Mass | 442.03 |
| IUPAC Name | N'-cyclohexa-2,4-dien-1-yl-N-[(3,5-dibromo-2-ethoxyphenyl)methyl]propane-1,3-diamine |
| SMILES | CCOc1c(Br)cc(Br)cc1CNCCCNC1C=CC=CC1 |
| InChI | InChI=1S/C18H24Br2N2O/c1-2-23-18-14(11-15(19)12-17(18)20)13-21-9-6-10-22-16-7-4-3-5-8-16/h3-5,7,11-12,16,21-22H,2,6,8-10,13H2,1H3 |
| InChIKey | XPUZSFUISHTSGA-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.21 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|