C12H18BrNO4S — CID 47267472
N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-2-methylsulfonylethanamine (PubChem CID 47267472) has the molecular formula C12H18BrNO4S and a molecular weight of 352.25 g/mol. Its IUPAC name is N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-2-methylsulfonylethanamine.
| Compound Name | N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-2-methylsulfonylethanamine |
|---|---|
| PubChem CID | 47267472 |
| Molecular Formula | C12H18BrNO4S |
| Molecular Weight | 352.25 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-2-methylsulfonylethanamine |
| SMILES | COc1cc(Br)c(CNCCS(C)(=O)=O)cc1OC |
| InChI | InChI=1S/C12H18BrNO4S/c1-17-11-6-9(10(13)7-12(11)18-2)8-14-4-5-19(3,15)16/h6-7,14H,4-5,8H2,1-3H3 |
| InChIKey | FHCKJSASRQTHKK-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.25 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|