C13H21NO5S — CID 60921052
2-methylsulfonyl-N-[(2,4,6-trimethoxyphenyl)methyl]ethanamine (PubChem CID 60921052) has the molecular formula C13H21NO5S and a molecular weight of 303.38 g/mol. Its IUPAC name is 2-methylsulfonyl-N-[(2,4,6-trimethoxyphenyl)methyl]ethanamine.
| Compound Name | 2-methylsulfonyl-N-[(2,4,6-trimethoxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 60921052 |
| Molecular Formula | C13H21NO5S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 2-methylsulfonyl-N-[(2,4,6-trimethoxyphenyl)methyl]ethanamine |
| SMILES | COc1cc(OC)c(CNCCS(C)(=O)=O)c(OC)c1 |
| InChI | InChI=1S/C13H21NO5S/c1-17-10-7-12(18-2)11(13(8-10)19-3)9-14-5-6-20(4,15)16/h7-8,14H,5-6,9H2,1-4H3 |
| InChIKey | VFKWDWQTDOSCIL-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|