C12H20N2O5S — CID 43551672
2-[(2,4,6-trimethoxyphenyl)methylamino]ethanesulfonamide (PubChem CID 43551672) has the molecular formula C12H20N2O5S and a molecular weight of 304.37 g/mol. Its IUPAC name is 2-[(2,4,6-trimethoxyphenyl)methylamino]ethanesulfonamide.
| Compound Name | 2-[(2,4,6-trimethoxyphenyl)methylamino]ethanesulfonamide |
|---|---|
| PubChem CID | 43551672 |
| Molecular Formula | C12H20N2O5S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 2-[(2,4,6-trimethoxyphenyl)methylamino]ethanesulfonamide |
| SMILES | COc1cc(OC)c(CNCCS(N)(=O)=O)c(OC)c1 |
| InChI | InChI=1S/C12H20N2O5S/c1-17-9-6-11(18-2)10(12(7-9)19-3)8-14-4-5-20(13,15)16/h6-7,14H,4-5,8H2,1-3H3,(H2,13,15,16) |
| InChIKey | WUVZTGVYNJMWAQ-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|