C11H16O6S — CID 102620850
(2,4,6-trimethoxyphenyl)methyl methanesulfonate (PubChem CID 102620850) has the molecular formula C11H16O6S and a molecular weight of 276.31 g/mol. Its IUPAC name is (2,4,6-trimethoxyphenyl)methyl methanesulfonate.
| Compound Name | (2,4,6-trimethoxyphenyl)methyl methanesulfonate |
|---|---|
| PubChem CID | 102620850 |
| Molecular Formula | C11H16O6S |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | (2,4,6-trimethoxyphenyl)methyl methanesulfonate |
| SMILES | COc1cc(OC)c(COS(C)(=O)=O)c(OC)c1 |
| InChI | InChI=1S/C11H16O6S/c1-14-8-5-10(15-2)9(11(6-8)16-3)7-17-18(4,12)13/h5-6H,7H2,1-4H3 |
| InChIKey | BTMLBWAQRLVQCF-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|