2-[(2,4,6-trimethoxyphenyl)methylsulfonyl]acetic acid

C12H16O7S — CID 18003795

IUPAC2-[(2,4,6-trimethoxyphenyl)methylsulfonyl]acetic acid
SMILESCOc1cc(OC)c(CS(=O)(=O)CC(=O)O)c(OC)c1
InChIInChI=1S/C12H16O7S/c1-17-8-4-10(18-2)9(11(5-8)19-3)6-20(15,16)7-12(13)14/h4-5H,6-7H2,1-3H3,(H,13,14)
InChIKeyCNRNOPCSRJYYQJ-UHFFFAOYSA-N
MW304.32 g/mol
LogP0.71
Rot. Bonds7

About 2-[(2,4,6-trimethoxyphenyl)methylsulfonyl]acetic acid

2-[(2,4,6-trimethoxyphenyl)methylsulfonyl]acetic acid (PubChem CID 18003795) has the molecular formula C12H16O7S and a molecular weight of 304.32 g/mol. Its IUPAC name is 2-[(2,4,6-trimethoxyphenyl)methylsulfonyl]acetic acid.

Molecular Properties

Compound Name2-[(2,4,6-trimethoxyphenyl)methylsulfonyl]acetic acid
PubChem CID18003795
Molecular FormulaC12H16O7S
Molecular Weight304.32 g/mol
Exact Mass304.06
IUPAC Name2-[(2,4,6-trimethoxyphenyl)methylsulfonyl]acetic acid
SMILESCOc1cc(OC)c(CS(=O)(=O)CC(=O)O)c(OC)c1
InChIInChI=1S/C12H16O7S/c1-17-8-4-10(18-2)9(11(5-8)19-3)6-20(15,16)7-12(13)14/h4-5H,6-7H2,1-3H3,(H,13,14)
InChIKeyCNRNOPCSRJYYQJ-UHFFFAOYSA-N
XLogP0.71
TPSA99.13 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds7
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500304.32
LogP ≤ 50.71
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze 2-[(2,4,6-trimethoxyphenyl)methylsulfonyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2,4,6-trimethoxyphenyl)methylsulfonyl]acetic acid?
The IUPAC name of 2-[(2,4,6-trimethoxyphenyl)methylsulfonyl]acetic acid (CID 18003795) is 2-[(2,4,6-trimethoxyphenyl)methylsulfonyl]acetic acid.
What is the SMILES notation for 2-[(2,4,6-trimethoxyphenyl)methylsulfonyl]acetic acid?
The canonical SMILES for 2-[(2,4,6-trimethoxyphenyl)methylsulfonyl]acetic acid is COc1cc(OC)c(CS(=O)(=O)CC(=O)O)c(OC)c1.
What is the InChIKey of 2-[(2,4,6-trimethoxyphenyl)methylsulfonyl]acetic acid?
The InChIKey is CNRNOPCSRJYYQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O7S/c1-17-8-4-10(18-2)9(11(5-8)19-3)6-20(15,16)7-12(13)14/h4-5H,6-7H2,1-3H3,(H,13,14).
What are the key properties of 2-[(2,4,6-trimethoxyphenyl)methylsulfonyl]acetic acid?
2-[(2,4,6-trimethoxyphenyl)methylsulfonyl]acetic acid has a molecular weight of 304.32 g/mol, XLogP of 0.71, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,4,6-trimethoxyphenyl)methylsulfonyl]acetic acid is sourced from PubChem (CID 18003795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).