C12H16O7S — CID 18003795
2-[(2,4,6-trimethoxyphenyl)methylsulfonyl]acetic acid (PubChem CID 18003795) has the molecular formula C12H16O7S and a molecular weight of 304.32 g/mol. Its IUPAC name is 2-[(2,4,6-trimethoxyphenyl)methylsulfonyl]acetic acid.
| Compound Name | 2-[(2,4,6-trimethoxyphenyl)methylsulfonyl]acetic acid |
|---|---|
| PubChem CID | 18003795 |
| Molecular Formula | C12H16O7S |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 2-[(2,4,6-trimethoxyphenyl)methylsulfonyl]acetic acid |
| SMILES | COc1cc(OC)c(CS(=O)(=O)CC(=O)O)c(OC)c1 |
| InChI | InChI=1S/C12H16O7S/c1-17-8-4-10(18-2)9(11(5-8)19-3)6-20(15,16)7-12(13)14/h4-5H,6-7H2,1-3H3,(H,13,14) |
| InChIKey | CNRNOPCSRJYYQJ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |