C10H13NO5 — CID 172824668
(2-hydroxy-4,6-dimethoxyphenyl)methylcarbamic acid (PubChem CID 172824668) has the molecular formula C10H13NO5 and a molecular weight of 227.22 g/mol. Its IUPAC name is (2-hydroxy-4,6-dimethoxyphenyl)methylcarbamic acid.
| Compound Name | (2-hydroxy-4,6-dimethoxyphenyl)methylcarbamic acid |
|---|---|
| PubChem CID | 172824668 |
| Molecular Formula | C10H13NO5 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | (2-hydroxy-4,6-dimethoxyphenyl)methylcarbamic acid |
| SMILES | COc1cc(O)c(CNC(=O)O)c(OC)c1 |
| InChI | InChI=1S/C10H13NO5/c1-15-6-3-8(12)7(5-11-10(13)14)9(4-6)16-2/h3-4,11-12H,5H2,1-2H3,(H,13,14) |
| InChIKey | URTPUWNELYNHIK-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|