(2-hydroxy-4,6-dimethoxyphenyl)methylcarbamic acid

C10H13NO5 — CID 172824668

IUPAC(2-hydroxy-4,6-dimethoxyphenyl)methylcarbamic acid
SMILESCOc1cc(O)c(CNC(=O)O)c(OC)c1
InChIInChI=1S/C10H13NO5/c1-15-6-3-8(12)7(5-11-10(13)14)9(4-6)16-2/h3-4,11-12H,5H2,1-2H3,(H,13,14)
InChIKeyURTPUWNELYNHIK-UHFFFAOYSA-N
MW227.22 g/mol
LogP1.18
Rot. Bonds4

About (2-hydroxy-4,6-dimethoxyphenyl)methylcarbamic acid

(2-hydroxy-4,6-dimethoxyphenyl)methylcarbamic acid (PubChem CID 172824668) has the molecular formula C10H13NO5 and a molecular weight of 227.22 g/mol. Its IUPAC name is (2-hydroxy-4,6-dimethoxyphenyl)methylcarbamic acid.

Molecular Properties

Compound Name(2-hydroxy-4,6-dimethoxyphenyl)methylcarbamic acid
PubChem CID172824668
Molecular FormulaC10H13NO5
Molecular Weight227.22 g/mol
Exact Mass227.08
IUPAC Name(2-hydroxy-4,6-dimethoxyphenyl)methylcarbamic acid
SMILESCOc1cc(O)c(CNC(=O)O)c(OC)c1
InChIInChI=1S/C10H13NO5/c1-15-6-3-8(12)7(5-11-10(13)14)9(4-6)16-2/h3-4,11-12H,5H2,1-2H3,(H,13,14)
InChIKeyURTPUWNELYNHIK-UHFFFAOYSA-N
XLogP1.18
TPSA88.02 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.22
LogP ≤ 51.18
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}

Analyze (2-hydroxy-4,6-dimethoxyphenyl)methylcarbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-hydroxy-4,6-dimethoxyphenyl)methylcarbamic acid?
The IUPAC name of (2-hydroxy-4,6-dimethoxyphenyl)methylcarbamic acid (CID 172824668) is (2-hydroxy-4,6-dimethoxyphenyl)methylcarbamic acid.
What is the SMILES notation for (2-hydroxy-4,6-dimethoxyphenyl)methylcarbamic acid?
The canonical SMILES for (2-hydroxy-4,6-dimethoxyphenyl)methylcarbamic acid is COc1cc(O)c(CNC(=O)O)c(OC)c1.
What is the InChIKey of (2-hydroxy-4,6-dimethoxyphenyl)methylcarbamic acid?
The InChIKey is URTPUWNELYNHIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO5/c1-15-6-3-8(12)7(5-11-10(13)14)9(4-6)16-2/h3-4,11-12H,5H2,1-2H3,(H,13,14).
What are the key properties of (2-hydroxy-4,6-dimethoxyphenyl)methylcarbamic acid?
(2-hydroxy-4,6-dimethoxyphenyl)methylcarbamic acid has a molecular weight of 227.22 g/mol, XLogP of 1.18, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxy-4,6-dimethoxyphenyl)methylcarbamic acid is sourced from PubChem (CID 172824668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).