C12H14N2O3 — CID 115172240
1-cyano-N-[(2,4-dimethoxy-6-methylphenyl)methyl]formamide (PubChem CID 115172240) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is 1-cyano-N-[(2,4-dimethoxy-6-methylphenyl)methyl]formamide.
| Compound Name | 1-cyano-N-[(2,4-dimethoxy-6-methylphenyl)methyl]formamide |
|---|---|
| PubChem CID | 115172240 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 1-cyano-N-[(2,4-dimethoxy-6-methylphenyl)methyl]formamide |
| SMILES | COc1cc(C)c(CNC(=O)C#N)c(OC)c1 |
| InChI | InChI=1S/C12H14N2O3/c1-8-4-9(16-2)5-11(17-3)10(8)7-14-12(15)6-13/h4-5H,7H2,1-3H3,(H,14,15) |
| InChIKey | VYMMHKORBWSDJC-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'} |
|---|