C12H14N2O4 — CID 115172248
1-cyano-N-[(3,4,5-trimethoxyphenyl)methyl]formamide (PubChem CID 115172248) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is 1-cyano-N-[(3,4,5-trimethoxyphenyl)methyl]formamide.
| Compound Name | 1-cyano-N-[(3,4,5-trimethoxyphenyl)methyl]formamide |
|---|---|
| PubChem CID | 115172248 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 1-cyano-N-[(3,4,5-trimethoxyphenyl)methyl]formamide |
| SMILES | COc1cc(CNC(=O)C#N)cc(OC)c1OC |
| InChI | InChI=1S/C12H14N2O4/c1-16-9-4-8(7-14-11(15)6-13)5-10(17-2)12(9)18-3/h4-5H,7H2,1-3H3,(H,14,15) |
| InChIKey | WMXXGNIPJUOBPI-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'} |
|---|