N-[(2,4-dimethoxy-6-methylphenyl)methyl]carbamoyl chloride

C11H14ClNO3 — CID 115194702

IUPACN-[(2,4-dimethoxy-6-methylphenyl)methyl]carbamoyl chloride
SMILESCOc1cc(C)c(CNC(=O)Cl)c(OC)c1
InChIInChI=1S/C11H14ClNO3/c1-7-4-8(15-2)5-10(16-3)9(7)6-13-11(12)14/h4-5H,6H2,1-3H3,(H,13,14)
InChIKeyHAHGKOHSYLFHQJ-UHFFFAOYSA-N
MW243.69 g/mol
LogP2.46
Rot. Bonds4

About N-[(2,4-dimethoxy-6-methylphenyl)methyl]carbamoyl chloride

N-[(2,4-dimethoxy-6-methylphenyl)methyl]carbamoyl chloride (PubChem CID 115194702) has the molecular formula C11H14ClNO3 and a molecular weight of 243.69 g/mol. Its IUPAC name is N-[(2,4-dimethoxy-6-methylphenyl)methyl]carbamoyl chloride.

Molecular Properties

Compound NameN-[(2,4-dimethoxy-6-methylphenyl)methyl]carbamoyl chloride
PubChem CID115194702
Molecular FormulaC11H14ClNO3
Molecular Weight243.69 g/mol
Exact Mass243.07
IUPAC NameN-[(2,4-dimethoxy-6-methylphenyl)methyl]carbamoyl chloride
SMILESCOc1cc(C)c(CNC(=O)Cl)c(OC)c1
InChIInChI=1S/C11H14ClNO3/c1-7-4-8(15-2)5-10(16-3)9(7)6-13-11(12)14/h4-5H,6H2,1-3H3,(H,13,14)
InChIKeyHAHGKOHSYLFHQJ-UHFFFAOYSA-N
XLogP2.46
TPSA47.56 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500243.69
LogP ≤ 52.46
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}

Analyze N-[(2,4-dimethoxy-6-methylphenyl)methyl]carbamoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-[(2,4-dimethoxy-6-methylphenyl)methyl]carbamoyl chloride?
The IUPAC name of N-[(2,4-dimethoxy-6-methylphenyl)methyl]carbamoyl chloride (CID 115194702) is N-[(2,4-dimethoxy-6-methylphenyl)methyl]carbamoyl chloride.
What is the SMILES notation for N-[(2,4-dimethoxy-6-methylphenyl)methyl]carbamoyl chloride?
The canonical SMILES for N-[(2,4-dimethoxy-6-methylphenyl)methyl]carbamoyl chloride is COc1cc(C)c(CNC(=O)Cl)c(OC)c1.
What is the InChIKey of N-[(2,4-dimethoxy-6-methylphenyl)methyl]carbamoyl chloride?
The InChIKey is HAHGKOHSYLFHQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14ClNO3/c1-7-4-8(15-2)5-10(16-3)9(7)6-13-11(12)14/h4-5H,6H2,1-3H3,(H,13,14).
What are the key properties of N-[(2,4-dimethoxy-6-methylphenyl)methyl]carbamoyl chloride?
N-[(2,4-dimethoxy-6-methylphenyl)methyl]carbamoyl chloride has a molecular weight of 243.69 g/mol, XLogP of 2.46, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2,4-dimethoxy-6-methylphenyl)methyl]carbamoyl chloride is sourced from PubChem (CID 115194702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).