C10H13NO4 — CID 67370524
(3,5-dimethoxyphenyl)methylcarbamic acid (PubChem CID 67370524) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is (3,5-dimethoxyphenyl)methylcarbamic acid.
| Compound Name | (3,5-dimethoxyphenyl)methylcarbamic acid |
|---|---|
| PubChem CID | 67370524 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | (3,5-dimethoxyphenyl)methylcarbamic acid |
| SMILES | COc1cc(CNC(=O)O)cc(OC)c1 |
| InChI | InChI=1S/C10H13NO4/c1-14-8-3-7(6-11-10(12)13)4-9(5-8)15-2/h3-5,11H,6H2,1-2H3,(H,12,13) |
| InChIKey | IYKWPVNCPDXWDC-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |