2-[(2,4-dimethoxyphenyl)sulfamoyl]acetic acid

C10H13NO6S — CID 28774020

IUPAC2-[(2,4-dimethoxyphenyl)sulfamoyl]acetic acid
SMILESCOc1ccc(NS(=O)(=O)CC(=O)O)c(OC)c1
InChIInChI=1S/C10H13NO6S/c1-16-7-3-4-8(9(5-7)17-2)11-18(14,15)6-10(12)13/h3-5,11H,6H2,1-2H3,(H,12,13)
InChIKeyFOLKJXAIXYETCJ-UHFFFAOYSA-N
MW275.28 g/mol
LogP0.53
Rot. Bonds6

About 2-[(2,4-dimethoxyphenyl)sulfamoyl]acetic acid

2-[(2,4-dimethoxyphenyl)sulfamoyl]acetic acid (PubChem CID 28774020) has the molecular formula C10H13NO6S and a molecular weight of 275.28 g/mol. Its IUPAC name is 2-[(2,4-dimethoxyphenyl)sulfamoyl]acetic acid.

Molecular Properties

Compound Name2-[(2,4-dimethoxyphenyl)sulfamoyl]acetic acid
PubChem CID28774020
Molecular FormulaC10H13NO6S
Molecular Weight275.28 g/mol
Exact Mass275.05
IUPAC Name2-[(2,4-dimethoxyphenyl)sulfamoyl]acetic acid
SMILESCOc1ccc(NS(=O)(=O)CC(=O)O)c(OC)c1
InChIInChI=1S/C10H13NO6S/c1-16-7-3-4-8(9(5-7)17-2)11-18(14,15)6-10(12)13/h3-5,11H,6H2,1-2H3,(H,12,13)
InChIKeyFOLKJXAIXYETCJ-UHFFFAOYSA-N
XLogP0.53
TPSA101.93 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.28
LogP ≤ 50.53
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-[(2,4-dimethoxyphenyl)sulfamoyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2,4-dimethoxyphenyl)sulfamoyl]acetic acid?
The IUPAC name of 2-[(2,4-dimethoxyphenyl)sulfamoyl]acetic acid (CID 28774020) is 2-[(2,4-dimethoxyphenyl)sulfamoyl]acetic acid.
What is the SMILES notation for 2-[(2,4-dimethoxyphenyl)sulfamoyl]acetic acid?
The canonical SMILES for 2-[(2,4-dimethoxyphenyl)sulfamoyl]acetic acid is COc1ccc(NS(=O)(=O)CC(=O)O)c(OC)c1.
What is the InChIKey of 2-[(2,4-dimethoxyphenyl)sulfamoyl]acetic acid?
The InChIKey is FOLKJXAIXYETCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO6S/c1-16-7-3-4-8(9(5-7)17-2)11-18(14,15)6-10(12)13/h3-5,11H,6H2,1-2H3,(H,12,13).
What are the key properties of 2-[(2,4-dimethoxyphenyl)sulfamoyl]acetic acid?
2-[(2,4-dimethoxyphenyl)sulfamoyl]acetic acid has a molecular weight of 275.28 g/mol, XLogP of 0.53, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,4-dimethoxyphenyl)sulfamoyl]acetic acid is sourced from PubChem (CID 28774020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).