C10H13NO6S — CID 28774020
2-[(2,4-dimethoxyphenyl)sulfamoyl]acetic acid (PubChem CID 28774020) has the molecular formula C10H13NO6S and a molecular weight of 275.28 g/mol. Its IUPAC name is 2-[(2,4-dimethoxyphenyl)sulfamoyl]acetic acid.
| Compound Name | 2-[(2,4-dimethoxyphenyl)sulfamoyl]acetic acid |
|---|---|
| PubChem CID | 28774020 |
| Molecular Formula | C10H13NO6S |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 2-[(2,4-dimethoxyphenyl)sulfamoyl]acetic acid |
| SMILES | COc1ccc(NS(=O)(=O)CC(=O)O)c(OC)c1 |
| InChI | InChI=1S/C10H13NO6S/c1-16-7-3-4-8(9(5-7)17-2)11-18(14,15)6-10(12)13/h3-5,11H,6H2,1-2H3,(H,12,13) |
| InChIKey | FOLKJXAIXYETCJ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |