(2,4-dimethoxyphenyl)hydrazine;oxalic acid

C10H14N2O6 — CID 138619968

IUPAC(2,4-dimethoxyphenyl)hydrazine;oxalic acid
SMILESCOc1ccc(NN)c(OC)c1.O=C(O)C(=O)O
InChIInChI=1S/C8H12N2O2.C2H2O4/c1-11-6-3-4-7(10-9)8(5-6)12-2;3-1(4)2(5)6/h3-5,10H,9H2,1-2H3;(H,3,4)(H,5,6)
InChIKeyJLVGMIGOEDDGMV-UHFFFAOYSA-N
MW258.23 g/mol
LogP0.14
Rot. Bonds3

About (2,4-dimethoxyphenyl)hydrazine;oxalic acid

(2,4-dimethoxyphenyl)hydrazine;oxalic acid (PubChem CID 138619968) has the molecular formula C10H14N2O6 and a molecular weight of 258.23 g/mol. Its IUPAC name is (2,4-dimethoxyphenyl)hydrazine;oxalic acid.

Molecular Properties

Compound Name(2,4-dimethoxyphenyl)hydrazine;oxalic acid
PubChem CID138619968
Molecular FormulaC10H14N2O6
Molecular Weight258.23 g/mol
Exact Mass258.09
IUPAC Name(2,4-dimethoxyphenyl)hydrazine;oxalic acid
SMILESCOc1ccc(NN)c(OC)c1.O=C(O)C(=O)O
InChIInChI=1S/C8H12N2O2.C2H2O4/c1-11-6-3-4-7(10-9)8(5-6)12-2;3-1(4)2(5)6/h3-5,10H,9H2,1-2H3;(H,3,4)(H,5,6)
InChIKeyJLVGMIGOEDDGMV-UHFFFAOYSA-N
XLogP0.14
TPSA131.11 Ų
H-Bond Donors4
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.23
LogP ≤ 50.14
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze (2,4-dimethoxyphenyl)hydrazine;oxalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,4-dimethoxyphenyl)hydrazine;oxalic acid?
The IUPAC name of (2,4-dimethoxyphenyl)hydrazine;oxalic acid (CID 138619968) is (2,4-dimethoxyphenyl)hydrazine;oxalic acid.
What is the SMILES notation for (2,4-dimethoxyphenyl)hydrazine;oxalic acid?
The canonical SMILES for (2,4-dimethoxyphenyl)hydrazine;oxalic acid is COc1ccc(NN)c(OC)c1.O=C(O)C(=O)O.
What is the InChIKey of (2,4-dimethoxyphenyl)hydrazine;oxalic acid?
The InChIKey is JLVGMIGOEDDGMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2.C2H2O4/c1-11-6-3-4-7(10-9)8(5-6)12-2;3-1(4)2(5)6/h3-5,10H,9H2,1-2H3;(H,3,4)(H,5,6).
What are the key properties of (2,4-dimethoxyphenyl)hydrazine;oxalic acid?
(2,4-dimethoxyphenyl)hydrazine;oxalic acid has a molecular weight of 258.23 g/mol, XLogP of 0.14, 3 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dimethoxyphenyl)hydrazine;oxalic acid is sourced from PubChem (CID 138619968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).