C10H17N3O4S — CID 84760955
N'-[(2,4-dimethoxyphenyl)sulfamoyl]ethane-1,2-diamine (PubChem CID 84760955) has the molecular formula C10H17N3O4S and a molecular weight of 275.33 g/mol. Its IUPAC name is N'-[(2,4-dimethoxyphenyl)sulfamoyl]ethane-1,2-diamine.
| Compound Name | N'-[(2,4-dimethoxyphenyl)sulfamoyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 84760955 |
| Molecular Formula | C10H17N3O4S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | N'-[(2,4-dimethoxyphenyl)sulfamoyl]ethane-1,2-diamine |
| SMILES | COc1ccc(NS(=O)(=O)NCCN)c(OC)c1 |
| InChI | InChI=1S/C10H17N3O4S/c1-16-8-3-4-9(10(7-8)17-2)13-18(14,15)12-6-5-11/h3-4,7,12-13H,5-6,11H2,1-2H3 |
| InChIKey | HWQBCYSZXMKOQI-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |