C9H12ClNO4S — CID 63665098
1-chloro-N-(2,5-dimethoxyphenyl)methanesulfonamide (PubChem CID 63665098) has the molecular formula C9H12ClNO4S and a molecular weight of 265.72 g/mol. Its IUPAC name is 1-chloro-N-(2,5-dimethoxyphenyl)methanesulfonamide.
| Compound Name | 1-chloro-N-(2,5-dimethoxyphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 63665098 |
| Molecular Formula | C9H12ClNO4S |
| Molecular Weight | 265.72 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | 1-chloro-N-(2,5-dimethoxyphenyl)methanesulfonamide |
| SMILES | COc1ccc(OC)c(NS(=O)(=O)CCl)c1 |
| InChI | InChI=1S/C9H12ClNO4S/c1-14-7-3-4-9(15-2)8(5-7)11-16(12,13)6-10/h3-5,11H,6H2,1-2H3 |
| InChIKey | WIVYBCVQTGWMJJ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.72 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|