C17H19NO6S — CID 28632724
methyl 4-[(2,5-dimethoxyphenyl)sulfamoylmethyl]benzoate (PubChem CID 28632724) has the molecular formula C17H19NO6S and a molecular weight of 365.41 g/mol. Its IUPAC name is methyl 4-[(2,5-dimethoxyphenyl)sulfamoylmethyl]benzoate.
| Compound Name | methyl 4-[(2,5-dimethoxyphenyl)sulfamoylmethyl]benzoate |
|---|---|
| PubChem CID | 28632724 |
| Molecular Formula | C17H19NO6S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | methyl 4-[(2,5-dimethoxyphenyl)sulfamoylmethyl]benzoate |
| SMILES | COC(=O)c1ccc(CS(=O)(=O)Nc2cc(OC)ccc2OC)cc1 |
| InChI | InChI=1S/C17H19NO6S/c1-22-14-8-9-16(23-2)15(10-14)18-25(20,21)11-12-4-6-13(7-5-12)17(19)24-3/h4-10,18H,11H2,1-3H3 |
| InChIKey | HGLNQBZUWTVHSX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |