C19H23NO6S — CID 92646898
methyl 4-[[(1R)-1-(3,4-dimethoxyphenyl)ethyl]sulfamoylmethyl]benzoate (PubChem CID 92646898) has the molecular formula C19H23NO6S and a molecular weight of 393.46 g/mol. Its IUPAC name is methyl 4-[[(1R)-1-(3,4-dimethoxyphenyl)ethyl]sulfamoylmethyl]benzoate.
| Compound Name | methyl 4-[[(1R)-1-(3,4-dimethoxyphenyl)ethyl]sulfamoylmethyl]benzoate |
|---|---|
| PubChem CID | 92646898 |
| Molecular Formula | C19H23NO6S |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | methyl 4-[[(1R)-1-(3,4-dimethoxyphenyl)ethyl]sulfamoylmethyl]benzoate |
| SMILES | COC(=O)c1ccc(CS(=O)(=O)N[C@H](C)c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C19H23NO6S/c1-13(16-9-10-17(24-2)18(11-16)25-3)20-27(22,23)12-14-5-7-15(8-6-14)19(21)26-4/h5-11,13,20H,12H2,1-4H3/t13-/m1/s1 |
| InChIKey | KJILOBHFLIIXIM-CYBMUJFWSA-N |
| XLogP | 2.67 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |