C21H27NO5S — CID 93486713
methyl 4-[[(1R)-1-(4-methoxyphenyl)-3-methylbutyl]sulfamoylmethyl]benzoate (PubChem CID 93486713) has the molecular formula C21H27NO5S and a molecular weight of 405.52 g/mol. Its IUPAC name is methyl 4-[[(1R)-1-(4-methoxyphenyl)-3-methylbutyl]sulfamoylmethyl]benzoate.
| Compound Name | methyl 4-[[(1R)-1-(4-methoxyphenyl)-3-methylbutyl]sulfamoylmethyl]benzoate |
|---|---|
| PubChem CID | 93486713 |
| Molecular Formula | C21H27NO5S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | methyl 4-[[(1R)-1-(4-methoxyphenyl)-3-methylbutyl]sulfamoylmethyl]benzoate |
| SMILES | COC(=O)c1ccc(CS(=O)(=O)N[C@H](CC(C)C)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C21H27NO5S/c1-15(2)13-20(17-9-11-19(26-3)12-10-17)22-28(24,25)14-16-5-7-18(8-6-16)21(23)27-4/h5-12,15,20,22H,13-14H2,1-4H3/t20-/m1/s1 |
| InChIKey | ROGXBIULBJHDEO-HXUWFJFHSA-N |
| XLogP | 3.69 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |