C19H23ClFNO3S — CID 94027446
1-(2-chloro-6-fluorophenyl)-N-[(1R)-1-(4-methoxyphenyl)-3-methylbutyl]methanesulfonamide (PubChem CID 94027446) has the molecular formula C19H23ClFNO3S and a molecular weight of 399.92 g/mol. Its IUPAC name is 1-(2-chloro-6-fluorophenyl)-N-[(1R)-1-(4-methoxyphenyl)-3-methylbutyl]methanesulfonamide.
| Compound Name | 1-(2-chloro-6-fluorophenyl)-N-[(1R)-1-(4-methoxyphenyl)-3-methylbutyl]methanesulfonamide |
|---|---|
| PubChem CID | 94027446 |
| Molecular Formula | C19H23ClFNO3S |
| Molecular Weight | 399.92 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | 1-(2-chloro-6-fluorophenyl)-N-[(1R)-1-(4-methoxyphenyl)-3-methylbutyl]methanesulfonamide |
| SMILES | COc1ccc([C@@H](CC(C)C)NS(=O)(=O)Cc2c(F)cccc2Cl)cc1 |
| InChI | InChI=1S/C19H23ClFNO3S/c1-13(2)11-19(14-7-9-15(25-3)10-8-14)22-26(23,24)12-16-17(20)5-4-6-18(16)21/h4-10,13,19,22H,11-12H2,1-3H3/t19-/m1/s1 |
| InChIKey | MIKMYMPAKQJVKZ-LJQANCHMSA-N |
| XLogP | 4.69 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.92 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |