C18H22ClNO2S — CID 92646316
1-(4-chlorophenyl)-N-[(1R)-3-methyl-1-phenylbutyl]methanesulfonamide (PubChem CID 92646316) has the molecular formula C18H22ClNO2S and a molecular weight of 351.90 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[(1R)-3-methyl-1-phenylbutyl]methanesulfonamide.
| Compound Name | 1-(4-chlorophenyl)-N-[(1R)-3-methyl-1-phenylbutyl]methanesulfonamide |
|---|---|
| PubChem CID | 92646316 |
| Molecular Formula | C18H22ClNO2S |
| Molecular Weight | 351.90 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[(1R)-3-methyl-1-phenylbutyl]methanesulfonamide |
| SMILES | CC(C)C[C@@H](NS(=O)(=O)Cc1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C18H22ClNO2S/c1-14(2)12-18(16-6-4-3-5-7-16)20-23(21,22)13-15-8-10-17(19)11-9-15/h3-11,14,18,20H,12-13H2,1-2H3/t18-/m1/s1 |
| InChIKey | TTYOBGUNVOGHLV-GOSISDBHSA-N |
| XLogP | 4.55 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.90 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |