C15H13F2NO4S — CID 92681454
methyl 4-[(2,4-difluorophenyl)sulfamoylmethyl]benzoate (PubChem CID 92681454) has the molecular formula C15H13F2NO4S and a molecular weight of 341.34 g/mol. Its IUPAC name is methyl 4-[(2,4-difluorophenyl)sulfamoylmethyl]benzoate.
| Compound Name | methyl 4-[(2,4-difluorophenyl)sulfamoylmethyl]benzoate |
|---|---|
| PubChem CID | 92681454 |
| Molecular Formula | C15H13F2NO4S |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | methyl 4-[(2,4-difluorophenyl)sulfamoylmethyl]benzoate |
| SMILES | COC(=O)c1ccc(CS(=O)(=O)Nc2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C15H13F2NO4S/c1-22-15(19)11-4-2-10(3-5-11)9-23(20,21)18-14-7-6-12(16)8-13(14)17/h2-8,18H,9H2,1H3 |
| InChIKey | GIGCPEHTSMNFJS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |