C11H17NO4S — CID 60640726
N-(2,5-dimethoxyphenyl)propane-1-sulfonamide (PubChem CID 60640726) has the molecular formula C11H17NO4S and a molecular weight of 259.33 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)propane-1-sulfonamide.
| Compound Name | N-(2,5-dimethoxyphenyl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 60640726 |
| Molecular Formula | C11H17NO4S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)Nc1cc(OC)ccc1OC |
| InChI | InChI=1S/C11H17NO4S/c1-4-7-17(13,14)12-10-8-9(15-2)5-6-11(10)16-3/h5-6,8,12H,4,7H2,1-3H3 |
| InChIKey | KCQYCDOQKQGRCE-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |