C17H21O5S2+ — CID 172853651
(benzyl-hydroxy-oxo-λ6-sulfanylidene)-[(2,4,6-trimethoxyphenyl)methyl]sulfanium (PubChem CID 172853651) has the molecular formula C17H21O5S2+ and a molecular weight of 369.48 g/mol. Its IUPAC name is (benzyl-hydroxy-oxo-λ6-sulfanylidene)-[(2,4,6-trimethoxyphenyl)methyl]sulfanium.
| Compound Name | (benzyl-hydroxy-oxo-λ6-sulfanylidene)-[(2,4,6-trimethoxyphenyl)methyl]sulfanium |
|---|---|
| PubChem CID | 172853651 |
| Molecular Formula | C17H21O5S2+ |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | (benzyl-hydroxy-oxo-λ6-sulfanylidene)-[(2,4,6-trimethoxyphenyl)methyl]sulfanium |
| SMILES | COc1cc(OC)c(C[S+]=S(=O)(O)Cc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C17H20O5S2/c1-20-14-9-16(21-2)15(17(10-14)22-3)11-23-24(18,19)12-13-7-5-4-6-8-13/h4-10H,11-12H2,1-3H3/p+1 |
| InChIKey | YKEJZBHASWAPLS-UHFFFAOYSA-O |
| XLogP | 3.17 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|