C19H23NO5 — CID 122044436
3-[3-[(2,4,6-trimethoxyphenyl)methylamino]phenyl]propanoic acid (PubChem CID 122044436) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is 3-[3-[(2,4,6-trimethoxyphenyl)methylamino]phenyl]propanoic acid.
| Compound Name | 3-[3-[(2,4,6-trimethoxyphenyl)methylamino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 122044436 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 3-[3-[(2,4,6-trimethoxyphenyl)methylamino]phenyl]propanoic acid |
| SMILES | COc1cc(OC)c(CNc2cccc(CCC(=O)O)c2)c(OC)c1 |
| InChI | InChI=1S/C19H23NO5/c1-23-15-10-17(24-2)16(18(11-15)25-3)12-20-14-6-4-5-13(9-14)7-8-19(21)22/h4-6,9-11,20H,7-8,12H2,1-3H3,(H,21,22) |
| InChIKey | NLNMKQUDAXLDST-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |