C21H26N2O5 — CID 122044482
3-[3-[[4-(2,4-dimethoxyanilino)-4-oxobutan-2-yl]amino]phenyl]propanoic acid (PubChem CID 122044482) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is 3-[3-[[4-(2,4-dimethoxyanilino)-4-oxobutan-2-yl]amino]phenyl]propanoic acid.
| Compound Name | 3-[3-[[4-(2,4-dimethoxyanilino)-4-oxobutan-2-yl]amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 122044482 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 3-[3-[[4-(2,4-dimethoxyanilino)-4-oxobutan-2-yl]amino]phenyl]propanoic acid |
| SMILES | COc1ccc(NC(=O)CC(C)Nc2cccc(CCC(=O)O)c2)c(OC)c1 |
| InChI | InChI=1S/C21H26N2O5/c1-14(22-16-6-4-5-15(12-16)7-10-21(25)26)11-20(24)23-18-9-8-17(27-2)13-19(18)28-3/h4-6,8-9,12-14,22H,7,10-11H2,1-3H3,(H,23,24)(H,25,26) |
| InChIKey | KKNHLLVTFXAVMJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |