C18H20ClNO4 — CID 122044178
3-[3-[(2-chloro-3,4-dimethoxyphenyl)methylamino]phenyl]propanoic acid (PubChem CID 122044178) has the molecular formula C18H20ClNO4 and a molecular weight of 349.81 g/mol. Its IUPAC name is 3-[3-[(2-chloro-3,4-dimethoxyphenyl)methylamino]phenyl]propanoic acid.
| Compound Name | 3-[3-[(2-chloro-3,4-dimethoxyphenyl)methylamino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 122044178 |
| Molecular Formula | C18H20ClNO4 |
| Molecular Weight | 349.81 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 3-[3-[(2-chloro-3,4-dimethoxyphenyl)methylamino]phenyl]propanoic acid |
| SMILES | COc1ccc(CNc2cccc(CCC(=O)O)c2)c(Cl)c1OC |
| InChI | InChI=1S/C18H20ClNO4/c1-23-15-8-7-13(17(19)18(15)24-2)11-20-14-5-3-4-12(10-14)6-9-16(21)22/h3-5,7-8,10,20H,6,9,11H2,1-2H3,(H,21,22) |
| InChIKey | QKRIICDGQRBTMJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.81 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |