C18H19F2NO4 — CID 122044374
3-[3-[[3-(difluoromethoxy)-4-methoxyphenyl]methylamino]phenyl]propanoic acid (PubChem CID 122044374) has the molecular formula C18H19F2NO4 and a molecular weight of 351.35 g/mol. Its IUPAC name is 3-[3-[[3-(difluoromethoxy)-4-methoxyphenyl]methylamino]phenyl]propanoic acid.
| Compound Name | 3-[3-[[3-(difluoromethoxy)-4-methoxyphenyl]methylamino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 122044374 |
| Molecular Formula | C18H19F2NO4 |
| Molecular Weight | 351.35 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 3-[3-[[3-(difluoromethoxy)-4-methoxyphenyl]methylamino]phenyl]propanoic acid |
| SMILES | COc1ccc(CNc2cccc(CCC(=O)O)c2)cc1OC(F)F |
| InChI | InChI=1S/C18H19F2NO4/c1-24-15-7-5-13(10-16(15)25-18(19)20)11-21-14-4-2-3-12(9-14)6-8-17(22)23/h2-5,7,9-10,18,21H,6,8,11H2,1H3,(H,22,23) |
| InChIKey | UVFJBTDMUVGILW-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.35 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |