C19H21F2NO4 — CID 122044373
3-[3-[[4-(difluoromethoxy)-3-ethoxyphenyl]methylamino]phenyl]propanoic acid (PubChem CID 122044373) has the molecular formula C19H21F2NO4 and a molecular weight of 365.38 g/mol. Its IUPAC name is 3-[3-[[4-(difluoromethoxy)-3-ethoxyphenyl]methylamino]phenyl]propanoic acid.
| Compound Name | 3-[3-[[4-(difluoromethoxy)-3-ethoxyphenyl]methylamino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 122044373 |
| Molecular Formula | C19H21F2NO4 |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 3-[3-[[4-(difluoromethoxy)-3-ethoxyphenyl]methylamino]phenyl]propanoic acid |
| SMILES | CCOc1cc(CNc2cccc(CCC(=O)O)c2)ccc1OC(F)F |
| InChI | InChI=1S/C19H21F2NO4/c1-2-25-17-11-14(6-8-16(17)26-19(20)21)12-22-15-5-3-4-13(10-15)7-9-18(23)24/h3-6,8,10-11,19,22H,2,7,9,12H2,1H3,(H,23,24) |
| InChIKey | AOOXMHYJEYCZIG-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |