C21H25F2NO3 — CID 55612210
N-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-N-methyl-3-(3-methylphenyl)propanamide (PubChem CID 55612210) has the molecular formula C21H25F2NO3 and a molecular weight of 377.43 g/mol. Its IUPAC name is N-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-N-methyl-3-(3-methylphenyl)propanamide.
| Compound Name | N-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-N-methyl-3-(3-methylphenyl)propanamide |
|---|---|
| PubChem CID | 55612210 |
| Molecular Formula | C21H25F2NO3 |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | N-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-N-methyl-3-(3-methylphenyl)propanamide |
| SMILES | CCOc1cc(CN(C)C(=O)CCc2cccc(C)c2)ccc1OC(F)F |
| InChI | InChI=1S/C21H25F2NO3/c1-4-26-19-13-17(8-10-18(19)27-21(22)23)14-24(3)20(25)11-9-16-7-5-6-15(2)12-16/h5-8,10,12-13,21H,4,9,11,14H2,1-3H3 |
| InChIKey | DRTIVJJDALKCSS-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |