C19H21F2NO3S — CID 55612167
N-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-N-methyl-2-phenylsulfanylacetamide (PubChem CID 55612167) has the molecular formula C19H21F2NO3S and a molecular weight of 381.44 g/mol. Its IUPAC name is N-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-N-methyl-2-phenylsulfanylacetamide.
| Compound Name | N-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-N-methyl-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 55612167 |
| Molecular Formula | C19H21F2NO3S |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | N-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-N-methyl-2-phenylsulfanylacetamide |
| SMILES | CCOc1cc(CN(C)C(=O)CSc2ccccc2)ccc1OC(F)F |
| InChI | InChI=1S/C19H21F2NO3S/c1-3-24-17-11-14(9-10-16(17)25-19(20)21)12-22(2)18(23)13-26-15-7-5-4-6-8-15/h4-11,19H,3,12-13H2,1-2H3 |
| InChIKey | LOJRGCLQMLNKIE-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |