C25H26F2N2O3 — CID 46406297
4-[[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl-methylamino]methyl]-N-phenylbenzamide (PubChem CID 46406297) has the molecular formula C25H26F2N2O3 and a molecular weight of 440.49 g/mol. Its IUPAC name is 4-[[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl-methylamino]methyl]-N-phenylbenzamide.
| Compound Name | 4-[[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl-methylamino]methyl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 46406297 |
| Molecular Formula | C25H26F2N2O3 |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | 4-[[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl-methylamino]methyl]-N-phenylbenzamide |
| SMILES | CCOc1cc(CN(C)Cc2ccc(C(=O)Nc3ccccc3)cc2)ccc1OC(F)F |
| InChI | InChI=1S/C25H26F2N2O3/c1-3-31-23-15-19(11-14-22(23)32-25(26)27)17-29(2)16-18-9-12-20(13-10-18)24(30)28-21-7-5-4-6-8-21/h4-15,25H,3,16-17H2,1-2H3,(H,28,30) |
| InChIKey | BKUZKMSDLPANJY-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |