C15H15F2N3O4 — CID 122047818
5-[[4-(difluoromethoxy)-3-ethoxyphenyl]methylamino]pyrazine-2-carboxylic acid (PubChem CID 122047818) has the molecular formula C15H15F2N3O4 and a molecular weight of 339.30 g/mol. Its IUPAC name is 5-[[4-(difluoromethoxy)-3-ethoxyphenyl]methylamino]pyrazine-2-carboxylic acid.
| Compound Name | 5-[[4-(difluoromethoxy)-3-ethoxyphenyl]methylamino]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 122047818 |
| Molecular Formula | C15H15F2N3O4 |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 5-[[4-(difluoromethoxy)-3-ethoxyphenyl]methylamino]pyrazine-2-carboxylic acid |
| SMILES | CCOc1cc(CNc2cnc(C(=O)O)cn2)ccc1OC(F)F |
| InChI | InChI=1S/C15H15F2N3O4/c1-2-23-12-5-9(3-4-11(12)24-15(16)17)6-19-13-8-18-10(7-20-13)14(21)22/h3-5,7-8,15H,2,6H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | UPRGHZNSZNRLKN-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |